About (5E)-3-ethylocta-1,5-diene
(5E)-3-ethylocta-1,5-diene (PubChem CID 5353002) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is (5E)-3-ethylocta-1,5-diene.
Molecular Properties
| Compound Name | (5E)-3-ethylocta-1,5-diene |
| PubChem CID | 5353002 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (5E)-3-ethylocta-1,5-diene |
| SMILES | C=CC(CC)C/C=C/CC |
| InChI | InChI=1S/C10H18/c1-4-7-8-9-10(5-2)6-3/h5,7-8,10H,2,4,6,9H2,1,3H3/b8-7+ |
| InChIKey | DXYBMKOHVHUXNV-BQYQJAHWSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-3-ethylocta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3-ethylocta-1,5-diene?
The IUPAC name of (5E)-3-ethylocta-1,5-diene (CID 5353002) is (5E)-3-ethylocta-1,5-diene.
What is the SMILES notation for (5E)-3-ethylocta-1,5-diene?
The canonical SMILES for (5E)-3-ethylocta-1,5-diene is C=CC(CC)C/C=C/CC.
What is the InChIKey of (5E)-3-ethylocta-1,5-diene?
The InChIKey is DXYBMKOHVHUXNV-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H18/c1-4-7-8-9-10(5-2)6-3/h5,7-8,10H,2,4,6,9H2,1,3H3/b8-7+.
What are the key properties of (5E)-3-ethylocta-1,5-diene?
(5E)-3-ethylocta-1,5-diene has a molecular weight of 138.25 g/mol, XLogP of 3.55, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3-ethylocta-1,5-diene is sourced from PubChem (CID 5353002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).