About (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate
(2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 5353081) has the molecular formula C17H13F3O2
and a molecular weight of 306.28 g/mol. Its IUPAC name is (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| PubChem CID | 5353081 |
| Molecular Formula | C17H13F3O2 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | Cc1ccccc1OC(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F3O2/c1-12-5-2-3-8-15(12)22-16(21)10-9-13-6-4-7-14(11-13)17(18,19)20/h2-11H,1H3/b10-9+ |
| InChIKey | GXXNUUCTTIPXNI-MDZDMXLPSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate?
The IUPAC name of (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (CID 5353081) is (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
What is the SMILES notation for (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate?
The canonical SMILES for (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate is Cc1ccccc1OC(=O)/C=C/c1cccc(C(F)(F)F)c1.
What is the InChIKey of (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate?
The InChIKey is GXXNUUCTTIPXNI-MDZDMXLPSA-N. The full InChI is InChI=1S/C17H13F3O2/c1-12-5-2-3-8-15(12)22-16(21)10-9-13-6-4-7-14(11-13)17(18,19)20/h2-11H,1H3/b10-9+.
What are the key properties of (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate?
(2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate has a molecular weight of 306.28 g/mol, XLogP of 4.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl) (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate is sourced from PubChem (CID 5353081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).