C14H22N2O2 — CID 535309
5,6,7,8,9,10,11,12,13,14-decahydro-1H-cyclododeca[d]pyrimidine-2,4-dione (PubChem CID 535309) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5,6,7,8,9,10,11,12,13,14-decahydro-1H-cyclododeca[d]pyrimidine-2,4-dione.
| Compound Name | 5,6,7,8,9,10,11,12,13,14-decahydro-1H-cyclododeca[d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 535309 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 5,6,7,8,9,10,11,12,13,14-decahydro-1H-cyclododeca[d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2c(c(=O)[nH]1)CCCCCCCCCC2 |
| InChI | InChI=1S/C14H22N2O2/c17-13-11-9-7-5-3-1-2-4-6-8-10-12(11)15-14(18)16-13/h1-10H2,(H2,15,16,17,18) |
| InChIKey | YMSXITGCVFIWFC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |