About (E)-icos-4-en-1-yn-3-ol
(E)-icos-4-en-1-yn-3-ol (PubChem CID 5353336) has the molecular formula C20H36O
and a molecular weight of 292.51 g/mol. Its IUPAC name is (E)-icos-4-en-1-yn-3-ol.
Molecular Properties
| Compound Name | (E)-icos-4-en-1-yn-3-ol |
| PubChem CID | 5353336 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | (E)-icos-4-en-1-yn-3-ol |
| SMILES | C#CC(O)/C=C/CCCCCCCCCCCCCCC |
| InChI | InChI=1S/C20H36O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)4-2/h2,18-21H,3,5-17H2,1H3/b19-18+ |
| InChIKey | MQUXQBHHZDPZOB-VHEBQXMUSA-N |
| XLogP | 6.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-icos-4-en-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-icos-4-en-1-yn-3-ol?
The IUPAC name of (E)-icos-4-en-1-yn-3-ol (CID 5353336) is (E)-icos-4-en-1-yn-3-ol.
What is the SMILES notation for (E)-icos-4-en-1-yn-3-ol?
The canonical SMILES for (E)-icos-4-en-1-yn-3-ol is C#CC(O)/C=C/CCCCCCCCCCCCCCC.
What is the InChIKey of (E)-icos-4-en-1-yn-3-ol?
The InChIKey is MQUXQBHHZDPZOB-VHEBQXMUSA-N. The full InChI is InChI=1S/C20H36O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)4-2/h2,18-21H,3,5-17H2,1H3/b19-18+.
What are the key properties of (E)-icos-4-en-1-yn-3-ol?
(E)-icos-4-en-1-yn-3-ol has a molecular weight of 292.51 g/mol, XLogP of 6.02, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-icos-4-en-1-yn-3-ol is sourced from PubChem (CID 5353336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).