About Carboxycinnamic Acid Bishydroxamide
Carboxycinnamic Acid Bishydroxamide (PubChem CID 5353484) has the molecular formula C10H10N2O4
and a molecular weight of 222.20 g/mol. Its IUPAC name is N-hydroxy-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide.
Molecular Properties
| Compound Name | Carboxycinnamic Acid Bishydroxamide |
| PubChem CID | 5353484 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | N-hydroxy-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide |
| SMILES | C1=CC(=CC(=C1)C(=O)NO)/C=C/C(=O)NO |
| InChI | InChI=1S/C10H10N2O4/c13-9(11-15)5-4-7-2-1-3-8(6-7)10(14)12-16/h1-6,15-16H,(H,11,13)(H,12,14)/b5-4+ |
| InChIKey | OYKBQNOPCSXWBL-SNAWJCMRSA-N |
| XLogP | -0.10 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 291 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Carboxycinnamic Acid Bishydroxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Carboxycinnamic Acid Bishydroxamide?
The IUPAC name of Carboxycinnamic Acid Bishydroxamide (CID 5353484) is N-hydroxy-3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]benzamide.
What is the SMILES notation for Carboxycinnamic Acid Bishydroxamide?
The canonical SMILES for Carboxycinnamic Acid Bishydroxamide is C1=CC(=CC(=C1)C(=O)NO)/C=C/C(=O)NO.
What is the InChIKey of Carboxycinnamic Acid Bishydroxamide?
The InChIKey is OYKBQNOPCSXWBL-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H10N2O4/c13-9(11-15)5-4-7-2-1-3-8(6-7)10(14)12-16/h1-6,15-16H,(H,11,13)(H,12,14)/b5-4+.
What are the key properties of Carboxycinnamic Acid Bishydroxamide?
Carboxycinnamic Acid Bishydroxamide has a molecular weight of 222.20 g/mol, XLogP of -0.10, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Carboxycinnamic Acid Bishydroxamide is sourced from PubChem (CID 5353484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).