About 7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile
7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile (PubChem CID 5353536) has the molecular formula C9H2N4O4
and a molecular weight of 230.14 g/mol.
Molecular Properties
| Compound Name | 7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile |
| PubChem CID | 5353536 |
| Molecular Formula | C9H2N4O4 |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | — |
| SMILES | N#Cc1cc2nc([O])c([O])nc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H2N4O4/c10-3-4-1-5-6(2-7(4)13(16)17)12-9(15)8(14)11-5/h1-2H |
| InChIKey | IAWXTSMHXFRLQR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 132.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile?
The IUPAC name of 7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile (CID 5353536) is not available.
What is the SMILES notation for 7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile?
The canonical SMILES for 7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile is N#Cc1cc2nc([O])c([O])nc2cc1[N+](=O)[O-].
What is the InChIKey of 7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile?
The InChIKey is IAWXTSMHXFRLQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H2N4O4/c10-3-4-1-5-6(2-7(4)13(16)17)12-9(15)8(14)11-5/h1-2H.
What are the key properties of 7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile?
7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile has a molecular weight of 230.14 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-Nitro-2,3-Dioxo-2,3-Dihydroquinoxaline-6-Carbonitrile is sourced from PubChem (CID 5353536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).