C10H18S — CID 535359
3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isothiochromene (PubChem CID 535359) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is 3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isothiochromene.
| Compound Name | 3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isothiochromene |
|---|---|
| PubChem CID | 535359 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isothiochromene |
| SMILES | CC1CC2CCCCC2CS1 |
| InChI | InChI=1S/C10H18S/c1-8-6-9-4-2-3-5-10(9)7-11-8/h8-10H,2-7H2,1H3 |
| InChIKey | SFJQLDPIISTORM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |