C17H28O2S — CID 5353623
2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylacetic acid (PubChem CID 5353623) has the molecular formula C17H28O2S and a molecular weight of 296.48 g/mol. Its IUPAC name is 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylacetic acid.
| Compound Name | 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 5353623 |
| Molecular Formula | C17H28O2S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylacetic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCC(=O)O |
| InChI | InChI=1S/C17H28O2S/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-20-13-17(18)19/h7,9,11H,5-6,8,10,12-13H2,1-4H3,(H,18,19)/b15-9+,16-11+ |
| InChIKey | GNWWFEVBHYESNK-XGGJEREUSA-N |
| XLogP | 5.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|