About (E)-but-2-enehydrazide
(E)-but-2-enehydrazide (PubChem CID 5354082) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is (E)-but-2-enehydrazide.
Molecular Properties
| Compound Name | (E)-but-2-enehydrazide |
| PubChem CID | 5354082 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | (E)-but-2-enehydrazide |
| SMILES | C/C=C/C(=O)NN |
| InChI | InChI=1S/C4H8N2O/c1-2-3-4(7)6-5/h2-3H,5H2,1H3,(H,6,7)/b3-2+ |
| InChIKey | MTANTOSWGQDIGK-NSCUHMNNSA-N |
| XLogP | -0.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enehydrazide?
The IUPAC name of (E)-but-2-enehydrazide (CID 5354082) is (E)-but-2-enehydrazide.
What is the SMILES notation for (E)-but-2-enehydrazide?
The canonical SMILES for (E)-but-2-enehydrazide is C/C=C/C(=O)NN.
What is the InChIKey of (E)-but-2-enehydrazide?
The InChIKey is MTANTOSWGQDIGK-NSCUHMNNSA-N. The full InChI is InChI=1S/C4H8N2O/c1-2-3-4(7)6-5/h2-3H,5H2,1H3,(H,6,7)/b3-2+.
What are the key properties of (E)-but-2-enehydrazide?
(E)-but-2-enehydrazide has a molecular weight of 100.12 g/mol, XLogP of -0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enehydrazide is sourced from PubChem (CID 5354082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).