About (2E)-2-hydroxyimino-1,2-diphenylethanol
(2E)-2-hydroxyimino-1,2-diphenylethanol (PubChem CID 5354084) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-1,2-diphenylethanol.
Molecular Properties
| Compound Name | (2E)-2-hydroxyimino-1,2-diphenylethanol |
| PubChem CID | 5354084 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (2E)-2-hydroxyimino-1,2-diphenylethanol |
| SMILES | O/N=C(\c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H13NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,14,16-17H/b15-13+ |
| InChIKey | WAKHLWOJMHVUJC-FYWRMAATSA-N |
| XLogP | 2.60 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-hydroxyimino-1,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-hydroxyimino-1,2-diphenylethanol?
The IUPAC name of (2E)-2-hydroxyimino-1,2-diphenylethanol (CID 5354084) is (2E)-2-hydroxyimino-1,2-diphenylethanol.
What is the SMILES notation for (2E)-2-hydroxyimino-1,2-diphenylethanol?
The canonical SMILES for (2E)-2-hydroxyimino-1,2-diphenylethanol is O/N=C(\c1ccccc1)C(O)c1ccccc1.
What is the InChIKey of (2E)-2-hydroxyimino-1,2-diphenylethanol?
The InChIKey is WAKHLWOJMHVUJC-FYWRMAATSA-N. The full InChI is InChI=1S/C14H13NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,14,16-17H/b15-13+.
What are the key properties of (2E)-2-hydroxyimino-1,2-diphenylethanol?
(2E)-2-hydroxyimino-1,2-diphenylethanol has a molecular weight of 227.26 g/mol, XLogP of 2.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-hydroxyimino-1,2-diphenylethanol is sourced from PubChem (CID 5354084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).