About (1E)-1-benzylideneindene
(1E)-1-benzylideneindene (PubChem CID 5354120) has the molecular formula C16H12
and a molecular weight of 204.27 g/mol. Its IUPAC name is (1E)-1-benzylideneindene.
Molecular Properties
| Compound Name | (1E)-1-benzylideneindene |
| PubChem CID | 5354120 |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (1E)-1-benzylideneindene |
| SMILES | C1=Cc2ccccc2/C1=C/c1ccccc1 |
| InChI | InChI=1S/C16H12/c1-2-6-13(7-3-1)12-15-11-10-14-8-4-5-9-16(14)15/h1-12H/b15-12+ |
| InChIKey | SJWIOZSGMUJDFJ-NTCAYCPXSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-benzylideneindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-benzylideneindene?
The IUPAC name of (1E)-1-benzylideneindene (CID 5354120) is (1E)-1-benzylideneindene.
What is the SMILES notation for (1E)-1-benzylideneindene?
The canonical SMILES for (1E)-1-benzylideneindene is C1=Cc2ccccc2/C1=C/c1ccccc1.
What is the InChIKey of (1E)-1-benzylideneindene?
The InChIKey is SJWIOZSGMUJDFJ-NTCAYCPXSA-N. The full InChI is InChI=1S/C16H12/c1-2-6-13(7-3-1)12-15-11-10-14-8-4-5-9-16(14)15/h1-12H/b15-12+.
What are the key properties of (1E)-1-benzylideneindene?
(1E)-1-benzylideneindene has a molecular weight of 204.27 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-benzylideneindene is sourced from PubChem (CID 5354120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).