About N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide
N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide (PubChem CID 5354526) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide.
Molecular Properties
| Compound Name | N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide |
| PubChem CID | 5354526 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)N=O |
| InChI | InChI=1S/C10H14N2O2/c1-8(12(2)11-14)10(13)9-6-4-3-5-7-9/h3-8,10,13H,1-2H3/t8-,10-/m0/s1 |
| InChIKey | ZVTOLKAVCZXHFM-WPRPVWTQSA-N |
| XLogP | 1.72 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide?
The IUPAC name of N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide (CID 5354526) is N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide.
What is the SMILES notation for N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide?
The canonical SMILES for N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide is C[C@@H]([C@H](O)c1ccccc1)N(C)N=O.
What is the InChIKey of N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide?
The InChIKey is ZVTOLKAVCZXHFM-WPRPVWTQSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-8(12(2)11-14)10(13)9-6-4-3-5-7-9/h3-8,10,13H,1-2H3/t8-,10-/m0/s1.
What are the key properties of N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide?
N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide has a molecular weight of 194.23 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide is sourced from PubChem (CID 5354526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).