(E)-3-phenylbut-2-enoic acid

C10H10O2 — CID 5354661

IUPAC(E)-3-phenylbut-2-enoic acid
SMILESC/C(=C\C(=O)O)c1ccccc1
InChIInChI=1S/C10H10O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12)/b8-7+
InChIKeyPEXWJYDPDXUVSV-BQYQJAHWSA-N
MW162.19 g/mol
LogP2.17
Rot. Bonds2

About (E)-3-phenylbut-2-enoic acid

(E)-3-phenylbut-2-enoic acid (PubChem CID 5354661) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (E)-3-phenylbut-2-enoic acid.

Molecular Properties

Compound Name(E)-3-phenylbut-2-enoic acid
PubChem CID5354661
Molecular FormulaC10H10O2
Molecular Weight162.19 g/mol
Exact Mass162.07
IUPAC Name(E)-3-phenylbut-2-enoic acid
SMILESC/C(=C\C(=O)O)c1ccccc1
InChIInChI=1S/C10H10O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12)/b8-7+
InChIKeyPEXWJYDPDXUVSV-BQYQJAHWSA-N
XLogP2.17
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.19
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-phenylbut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-phenylbut-2-enoic acid?
The IUPAC name of (E)-3-phenylbut-2-enoic acid (CID 5354661) is (E)-3-phenylbut-2-enoic acid.
What is the SMILES notation for (E)-3-phenylbut-2-enoic acid?
The canonical SMILES for (E)-3-phenylbut-2-enoic acid is C/C(=C\C(=O)O)c1ccccc1.
What is the InChIKey of (E)-3-phenylbut-2-enoic acid?
The InChIKey is PEXWJYDPDXUVSV-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H10O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12)/b8-7+.
What are the key properties of (E)-3-phenylbut-2-enoic acid?
(E)-3-phenylbut-2-enoic acid has a molecular weight of 162.19 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-phenylbut-2-enoic acid is sourced from PubChem (CID 5354661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).