C25H46N2 — CID 5354707
2-[(8E,11E)-heptadeca-8,11-dienyl]-5,5-dimethyl-3-propan-2-yl-4H-imidazole (PubChem CID 5354707) has the molecular formula C25H46N2 and a molecular weight of 374.66 g/mol. Its IUPAC name is 2-[(8E,11E)-heptadeca-8,11-dienyl]-5,5-dimethyl-3-propan-2-yl-4H-imidazole.
| Compound Name | 2-[(8E,11E)-heptadeca-8,11-dienyl]-5,5-dimethyl-3-propan-2-yl-4H-imidazole |
|---|---|
| PubChem CID | 5354707 |
| Molecular Formula | C25H46N2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 374.37 |
| IUPAC Name | 2-[(8E,11E)-heptadeca-8,11-dienyl]-5,5-dimethyl-3-propan-2-yl-4H-imidazole |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC1=NC(C)(C)CN1C(C)C |
| InChI | InChI=1S/C25H46N2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-26-25(4,5)22-27(24)23(2)3/h10-11,13-14,23H,6-9,12,15-22H2,1-5H3/b11-10+,14-13+ |
| InChIKey | FJQBQHDALVQQQD-IWCZYTNJSA-N |
| XLogP | 7.70 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|