About [(2Z)-3,7-dimethylocta-2,6-dienyl] formate
[(2Z)-3,7-dimethylocta-2,6-dienyl] formate (PubChem CID 5354882) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl] formate.
Molecular Properties
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] formate |
| PubChem CID | 5354882 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] formate |
| SMILES | CC(C)=CCC/C(C)=C\COC=O |
| InChI | InChI=1S/C11H18O2/c1-10(2)5-4-6-11(3)7-8-13-9-12/h5,7,9H,4,6,8H2,1-3H3/b11-7- |
| InChIKey | FQMZVFJYMPNUCT-XFFZJAGNSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-3,7-dimethylocta-2,6-dienyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] formate?
The IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] formate (CID 5354882) is [(2Z)-3,7-dimethylocta-2,6-dienyl] formate.
What is the SMILES notation for [(2Z)-3,7-dimethylocta-2,6-dienyl] formate?
The canonical SMILES for [(2Z)-3,7-dimethylocta-2,6-dienyl] formate is CC(C)=CCC/C(C)=C\COC=O.
What is the InChIKey of [(2Z)-3,7-dimethylocta-2,6-dienyl] formate?
The InChIKey is FQMZVFJYMPNUCT-XFFZJAGNSA-N. The full InChI is InChI=1S/C11H18O2/c1-10(2)5-4-6-11(3)7-8-13-9-12/h5,7,9H,4,6,8H2,1-3H3/b11-7-.
What are the key properties of [(2Z)-3,7-dimethylocta-2,6-dienyl] formate?
[(2Z)-3,7-dimethylocta-2,6-dienyl] formate has a molecular weight of 182.26 g/mol, XLogP of 2.85, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-3,7-dimethylocta-2,6-dienyl] formate is sourced from PubChem (CID 5354882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).