About 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane
3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane (PubChem CID 535493) has the molecular formula C9H12Br3N
and a molecular weight of 373.91 g/mol. Its IUPAC name is 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane.
Molecular Properties
| Compound Name | 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane |
| PubChem CID | 535493 |
| Molecular Formula | C9H12Br3N |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 370.85 |
| IUPAC Name | 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane |
| SMILES | BrC12CN3CC(Br)(C1)CC(Br)(C3)C2 |
| InChI | InChI=1S/C9H12Br3N/c10-7-1-8(11)3-9(12,2-7)6-13(4-7)5-8/h1-6H2 |
| InChIKey | GHJYRZFZOJQXND-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane?
The IUPAC name of 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane (CID 535493) is 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane.
What is the SMILES notation for 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane?
The canonical SMILES for 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane is BrC12CN3CC(Br)(C1)CC(Br)(C3)C2.
What is the InChIKey of 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane?
The InChIKey is GHJYRZFZOJQXND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Br3N/c10-7-1-8(11)3-9(12,2-7)6-13(4-7)5-8/h1-6H2.
What are the key properties of 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane?
3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane has a molecular weight of 373.91 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,7-tribromo-1-azatricyclo[3.3.1.13,7]decane is sourced from PubChem (CID 535493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).