C17H29N3O3 — CID 5355001
4-[2-[(2E)-2-(dimethylhydrazinylidene)-3,5-dimethylcyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione (PubChem CID 5355001) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-[2-[(2E)-2-(dimethylhydrazinylidene)-3,5-dimethylcyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione.
| Compound Name | 4-[2-[(2E)-2-(dimethylhydrazinylidene)-3,5-dimethylcyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 5355001 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 4-[2-[(2E)-2-(dimethylhydrazinylidene)-3,5-dimethylcyclohexyl]-2-hydroxyethyl]piperidine-2,6-dione |
| SMILES | CC1CC(C)/C(=N\N(C)C)C(C(O)CC2CC(=O)NC(=O)C2)C1 |
| InChI | InChI=1S/C17H29N3O3/c1-10-5-11(2)17(19-20(3)4)13(6-10)14(21)7-12-8-15(22)18-16(23)9-12/h10-14,21H,5-9H2,1-4H3,(H,18,22,23)/b19-17+ |
| InChIKey | GROLGEKMXLXQLA-HTXNQAPBSA-N |
| XLogP | 1.39 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|