About 6-amino-7,9-dihydropurin-8-one
6-amino-7,9-dihydropurin-8-one (PubChem CID 5355054) has the molecular formula C5H5N5O
and a molecular weight of 151.13 g/mol. Its IUPAC name is 6-amino-7,9-dihydropurin-8-one.
Molecular Properties
| Compound Name | 6-amino-7,9-dihydropurin-8-one |
| PubChem CID | 5355054 |
| Molecular Formula | C5H5N5O |
| Molecular Weight | 151.13 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 6-amino-7,9-dihydropurin-8-one |
| SMILES | Nc1ncnc2[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C5H5N5O/c6-3-2-4(8-1-7-3)10-5(11)9-2/h1H,(H4,6,7,8,9,10,11) |
| InChIKey | RGKBRPAAQSHTED-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.13 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-7,9-dihydropurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-7,9-dihydropurin-8-one?
The IUPAC name of 6-amino-7,9-dihydropurin-8-one (CID 5355054) is 6-amino-7,9-dihydropurin-8-one.
What is the SMILES notation for 6-amino-7,9-dihydropurin-8-one?
The canonical SMILES for 6-amino-7,9-dihydropurin-8-one is Nc1ncnc2[nH]c(=O)[nH]c12.
What is the InChIKey of 6-amino-7,9-dihydropurin-8-one?
The InChIKey is RGKBRPAAQSHTED-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O/c6-3-2-4(8-1-7-3)10-5(11)9-2/h1H,(H4,6,7,8,9,10,11).
What are the key properties of 6-amino-7,9-dihydropurin-8-one?
6-amino-7,9-dihydropurin-8-one has a molecular weight of 151.13 g/mol, XLogP of -0.77, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-7,9-dihydropurin-8-one is sourced from PubChem (CID 5355054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).