About 1H-imidazo[4,5-d]pyridazine-4,7-diamine
1H-imidazo[4,5-d]pyridazine-4,7-diamine (PubChem CID 5355150) has the molecular formula C5H6N6
and a molecular weight of 150.15 g/mol. Its IUPAC name is 1H-imidazo[4,5-d]pyridazine-4,7-diamine.
Molecular Properties
| Compound Name | 1H-imidazo[4,5-d]pyridazine-4,7-diamine |
| PubChem CID | 5355150 |
| Molecular Formula | C5H6N6 |
| Molecular Weight | 150.15 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 1H-imidazo[4,5-d]pyridazine-4,7-diamine |
| SMILES | Nc1nnc(N)c2[nH]cnc12 |
| InChI | InChI=1S/C5H6N6/c6-4-2-3(9-1-8-2)5(7)11-10-4/h1H,(H2,6,10)(H2,7,11)(H,8,9) |
| InChIKey | UMLCZSAOYUCVKU-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.15 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1H-imidazo[4,5-d]pyridazine-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazo[4,5-d]pyridazine-4,7-diamine?
The IUPAC name of 1H-imidazo[4,5-d]pyridazine-4,7-diamine (CID 5355150) is 1H-imidazo[4,5-d]pyridazine-4,7-diamine.
What is the SMILES notation for 1H-imidazo[4,5-d]pyridazine-4,7-diamine?
The canonical SMILES for 1H-imidazo[4,5-d]pyridazine-4,7-diamine is Nc1nnc(N)c2[nH]cnc12.
What is the InChIKey of 1H-imidazo[4,5-d]pyridazine-4,7-diamine?
The InChIKey is UMLCZSAOYUCVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N6/c6-4-2-3(9-1-8-2)5(7)11-10-4/h1H,(H2,6,10)(H2,7,11)(H,8,9).
What are the key properties of 1H-imidazo[4,5-d]pyridazine-4,7-diamine?
1H-imidazo[4,5-d]pyridazine-4,7-diamine has a molecular weight of 150.15 g/mol, XLogP of -0.48, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazo[4,5-d]pyridazine-4,7-diamine is sourced from PubChem (CID 5355150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).