About 1,3-dimethylazetidine
1,3-dimethylazetidine (PubChem CID 535545) has the molecular formula C5H11N
and a molecular weight of 85.15 g/mol. Its IUPAC name is 1,3-dimethylazetidine.
Molecular Properties
| Compound Name | 1,3-dimethylazetidine |
| PubChem CID | 535545 |
| Molecular Formula | C5H11N |
| Molecular Weight | 85.15 g/mol |
| Exact Mass | 85.09 |
| IUPAC Name | 1,3-dimethylazetidine |
| SMILES | CC1CN(C)C1 |
| InChI | InChI=1S/C5H11N/c1-5-3-6(2)4-5/h5H,3-4H2,1-2H3 |
| InChIKey | ILBZSNOGPTUKHC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.15 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dimethylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylazetidine?
The IUPAC name of 1,3-dimethylazetidine (CID 535545) is 1,3-dimethylazetidine.
What is the SMILES notation for 1,3-dimethylazetidine?
The canonical SMILES for 1,3-dimethylazetidine is CC1CN(C)C1.
What is the InChIKey of 1,3-dimethylazetidine?
The InChIKey is ILBZSNOGPTUKHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N/c1-5-3-6(2)4-5/h5H,3-4H2,1-2H3.
What are the key properties of 1,3-dimethylazetidine?
1,3-dimethylazetidine has a molecular weight of 85.15 g/mol, XLogP of 0.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylazetidine is sourced from PubChem (CID 535545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).