C18H31NO2 — CID 5355515
1-ethyl-3-[(Z)-2,4,6-trimethylnon-3-en-2-yl]pyrrolidine-2,5-dione (PubChem CID 5355515) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-ethyl-3-[(Z)-2,4,6-trimethylnon-3-en-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-ethyl-3-[(Z)-2,4,6-trimethylnon-3-en-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5355515 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 1-ethyl-3-[(Z)-2,4,6-trimethylnon-3-en-2-yl]pyrrolidine-2,5-dione |
| SMILES | CCCC(C)C/C(C)=C\C(C)(C)C1CC(=O)N(CC)C1=O |
| InChI | InChI=1S/C18H31NO2/c1-7-9-13(3)10-14(4)12-18(5,6)15-11-16(20)19(8-2)17(15)21/h12-13,15H,7-11H2,1-6H3/b14-12- |
| InChIKey | XKMROZHMCQRPFJ-OWBHPGMISA-N |
| XLogP | 4.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|