C12H24O2 — CID 5355525
(E)-1,1-dibutoxybut-2-ene (PubChem CID 5355525) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (E)-1,1-dibutoxybut-2-ene.
| Compound Name | (E)-1,1-dibutoxybut-2-ene |
|---|---|
| PubChem CID | 5355525 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (E)-1,1-dibutoxybut-2-ene |
| SMILES | C/C=C/C(OCCCC)OCCCC |
| InChI | InChI=1S/C12H24O2/c1-4-7-10-13-12(9-6-3)14-11-8-5-2/h6,9,12H,4-5,7-8,10-11H2,1-3H3/b9-6+ |
| InChIKey | UPMSRELUNHYHDW-RMKNXTFCSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|