About N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide
N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide (PubChem CID 53555283) has the molecular formula C17H28N4O2
and a molecular weight of 320.40 g/mol. Its IUPAC name is N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide |
| PubChem CID | 53555283 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide |
| SMILES | CC1=CC(=NN1CC2CN(CCO2)CC(=O)NC3CCCC3)C |
| InChI | InChI=1S/C17H28N4O2/c1-13-9-14(2)21(19-13)11-16-10-20(7-8-23-16)12-17(22)18-15-5-3-4-6-15/h9,15-16H,3-8,10-12H2,1-2H3,(H,18,22) |
| InChIKey | AIVCSANDPJSZAO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | 400 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide?
The IUPAC name of N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide (CID 53555283) is N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide.
What is the SMILES notation for N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide?
The canonical SMILES for N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide is CC1=CC(=NN1CC2CN(CCO2)CC(=O)NC3CCCC3)C.
What is the InChIKey of N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide?
The InChIKey is AIVCSANDPJSZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O2/c1-13-9-14(2)21(19-13)11-16-10-20(7-8-23-16)12-17(22)18-15-5-3-4-6-15/h9,15-16H,3-8,10-12H2,1-2H3,(H,18,22).
What are the key properties of N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide?
N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide has a molecular weight of 320.40 g/mol, XLogP of 1.30, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide is sourced from PubChem (CID 53555283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).