C22H25NO2 — CID 5355564
(Z)-2-amino-1,4-bis(2,4,6-trimethylphenyl)but-2-ene-1,4-dione (PubChem CID 5355564) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is (Z)-2-amino-1,4-bis(2,4,6-trimethylphenyl)but-2-ene-1,4-dione.
| Compound Name | (Z)-2-amino-1,4-bis(2,4,6-trimethylphenyl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 5355564 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (Z)-2-amino-1,4-bis(2,4,6-trimethylphenyl)but-2-ene-1,4-dione |
| SMILES | Cc1cc(C)c(C(=O)/C=C(\N)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C22H25NO2/c1-12-7-14(3)20(15(4)8-12)19(24)11-18(23)22(25)21-16(5)9-13(2)10-17(21)6/h7-11H,23H2,1-6H3/b18-11- |
| InChIKey | DHTQAYDESJSTLM-WQRHYEAKSA-N |
| XLogP | 4.45 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|