C15H24N2 — CID 5355638
(E)-N,N,N',N'-tetrakis(prop-2-enyl)prop-1-ene-1,3-diamine (PubChem CID 5355638) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is (E)-N,N,N',N'-tetrakis(prop-2-enyl)prop-1-ene-1,3-diamine.
| Compound Name | (E)-N,N,N',N'-tetrakis(prop-2-enyl)prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 5355638 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (E)-N,N,N',N'-tetrakis(prop-2-enyl)prop-1-ene-1,3-diamine |
| SMILES | C=CCN(/C=C/CN(CC=C)CC=C)CC=C |
| InChI | InChI=1S/C15H24N2/c1-5-10-16(11-6-2)14-9-15-17(12-7-3)13-8-4/h5-9,14H,1-4,10-13,15H2/b14-9+ |
| InChIKey | HDBQBOOGLFIDHO-NTEUORMPSA-N |
| XLogP | 2.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|