C16H26N2O4 — CID 5355645
7-(azepan-1-yl)-3,4,5,6-tetrahydro-2H-azepine;(Z)-but-2-enedioic acid (PubChem CID 5355645) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 7-(azepan-1-yl)-3,4,5,6-tetrahydro-2H-azepine;(Z)-but-2-enedioic acid.
| Compound Name | 7-(azepan-1-yl)-3,4,5,6-tetrahydro-2H-azepine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 5355645 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 7-(azepan-1-yl)-3,4,5,6-tetrahydro-2H-azepine;(Z)-but-2-enedioic acid |
| SMILES | C1CCN=C(N2CCCCCC2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C12H22N2.C4H4O4/c1-2-7-11-14(10-6-1)12-8-4-3-5-9-13-12;5-3(6)1-2-4(7)8/h1-11H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | IHZSIVPSGWIGFH-BTJKTKAUSA-N |
| XLogP | 2.55 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|