About [(E)-1,2-dichloroethenyl]benzene
[(E)-1,2-dichloroethenyl]benzene (PubChem CID 5356088) has the molecular formula C8H6Cl2
and a molecular weight of 173.04 g/mol. Its IUPAC name is [(E)-1,2-dichloroethenyl]benzene.
Molecular Properties
| Compound Name | [(E)-1,2-dichloroethenyl]benzene |
| PubChem CID | 5356088 |
| Molecular Formula | C8H6Cl2 |
| Molecular Weight | 173.04 g/mol |
| Exact Mass | 171.98 |
| IUPAC Name | [(E)-1,2-dichloroethenyl]benzene |
| SMILES | Cl/C=C(/Cl)c1ccccc1 |
| InChI | InChI=1S/C8H6Cl2/c9-6-8(10)7-4-2-1-3-5-7/h1-6H/b8-6+ |
| InChIKey | OQGSCHGFHOSXFY-SOFGYWHQSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.04 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [(E)-1,2-dichloroethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1,2-dichloroethenyl]benzene?
The IUPAC name of [(E)-1,2-dichloroethenyl]benzene (CID 5356088) is [(E)-1,2-dichloroethenyl]benzene.
What is the SMILES notation for [(E)-1,2-dichloroethenyl]benzene?
The canonical SMILES for [(E)-1,2-dichloroethenyl]benzene is Cl/C=C(/Cl)c1ccccc1.
What is the InChIKey of [(E)-1,2-dichloroethenyl]benzene?
The InChIKey is OQGSCHGFHOSXFY-SOFGYWHQSA-N. The full InChI is InChI=1S/C8H6Cl2/c9-6-8(10)7-4-2-1-3-5-7/h1-6H/b8-6+.
What are the key properties of [(E)-1,2-dichloroethenyl]benzene?
[(E)-1,2-dichloroethenyl]benzene has a molecular weight of 173.04 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1,2-dichloroethenyl]benzene is sourced from PubChem (CID 5356088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).