About N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide
N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide (PubChem CID 5356472) has the molecular formula C15H19N3O
and a molecular weight of 257.34 g/mol. Its IUPAC name is N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide |
| PubChem CID | 5356472 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide |
| SMILES | CC1=C/C(=N/NC(=O)c2ccncc2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H19N3O/c1-11-8-13(10-15(2,3)9-11)17-18-14(19)12-4-6-16-7-5-12/h4-8H,9-10H2,1-3H3,(H,18,19)/b17-13- |
| InChIKey | TUNOKQRAOHXRJU-LGMDPLHJSA-N |
| XLogP | 2.93 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide?
The IUPAC name of N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide (CID 5356472) is N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide.
What is the SMILES notation for N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide?
The canonical SMILES for N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide is CC1=C/C(=N/NC(=O)c2ccncc2)CC(C)(C)C1.
What is the InChIKey of N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide?
The InChIKey is TUNOKQRAOHXRJU-LGMDPLHJSA-N. The full InChI is InChI=1S/C15H19N3O/c1-11-8-13(10-15(2,3)9-11)17-18-14(19)12-4-6-16-7-5-12/h4-8H,9-10H2,1-3H3,(H,18,19)/b17-13-.
What are the key properties of N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide?
N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide has a molecular weight of 257.34 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]pyridine-4-carboxamide is sourced from PubChem (CID 5356472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).