About (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile
(Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile (PubChem CID 5356509) has the molecular formula C6H4N4
and a molecular weight of 132.13 g/mol. Its IUPAC name is (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile.
Molecular Properties
| Compound Name | (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile |
| PubChem CID | 5356509 |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile |
| SMILES | N#C/C=C(\N)C(C#N)C#N |
| InChI | InChI=1S/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h1,5H,10H2/b6-1- |
| InChIKey | QDRKCNWQSUBLGZ-BHQIHCQQSA-N |
| XLogP | 0.02 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile?
The IUPAC name of (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile (CID 5356509) is (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile.
What is the SMILES notation for (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile?
The canonical SMILES for (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile is N#C/C=C(\N)C(C#N)C#N.
What is the InChIKey of (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile?
The InChIKey is QDRKCNWQSUBLGZ-BHQIHCQQSA-N. The full InChI is InChI=1S/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h1,5H,10H2/b6-1-.
What are the key properties of (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile?
(Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile has a molecular weight of 132.13 g/mol, XLogP of 0.02, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-aminoprop-2-ene-1,1,3-tricarbonitrile is sourced from PubChem (CID 5356509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).