About 4-chloro-7H-pyrrolo[2,3-d]pyrimidine
4-chloro-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 5356682) has the molecular formula C6H4ClN3
and a molecular weight of 153.57 g/mol. Its IUPAC name is 4-chloro-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 5356682 |
| Molecular Formula | C6H4ClN3 |
| Molecular Weight | 153.57 g/mol |
| Exact Mass | 153.01 |
| IUPAC Name | 4-chloro-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Clc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C6H4ClN3/c7-5-4-1-2-8-6(4)10-3-9-5/h1-3H,(H,8,9,10) |
| InChIKey | BPTCCCTWWAUJRK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.57 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-chloro-7H-pyrrolo[2,3-d]pyrimidine (CID 5356682) is 4-chloro-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-chloro-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-chloro-7H-pyrrolo[2,3-d]pyrimidine is Clc1ncnc2[nH]ccc12.
What is the InChIKey of 4-chloro-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is BPTCCCTWWAUJRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN3/c7-5-4-1-2-8-6(4)10-3-9-5/h1-3H,(H,8,9,10).
What are the key properties of 4-chloro-7H-pyrrolo[2,3-d]pyrimidine?
4-chloro-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 153.57 g/mol, XLogP of 1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 5356682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).