C10H18N4 — CID 535677
3,6-ditert-butyl-1,2,4,5-tetrazine (PubChem CID 535677) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 3,6-ditert-butyl-1,2,4,5-tetrazine.
| Compound Name | 3,6-ditert-butyl-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 535677 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 3,6-ditert-butyl-1,2,4,5-tetrazine |
| SMILES | CC(C)(C)c1nnc(C(C)(C)C)nn1 |
| InChI | InChI=1S/C10H18N4/c1-9(2,3)7-11-13-8(14-12-7)10(4,5)6/h1-6H3 |
| InChIKey | BVARMSJELYFCRL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |