C9H17NO2 — CID 535695
2-(methylamino)octane-3,5-dione (PubChem CID 535695) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-(methylamino)octane-3,5-dione.
| Compound Name | 2-(methylamino)octane-3,5-dione |
|---|---|
| PubChem CID | 535695 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 2-(methylamino)octane-3,5-dione |
| SMILES | CCCC(=O)CC(=O)C(C)NC |
| InChI | InChI=1S/C9H17NO2/c1-4-5-8(11)6-9(12)7(2)10-3/h7,10H,4-6H2,1-3H3 |
| InChIKey | LHSAIYLXFKYXAJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|