About cyclohexyl (E)-3-phenylprop-2-enoate
cyclohexyl (E)-3-phenylprop-2-enoate (PubChem CID 5357153) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is cyclohexyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | cyclohexyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 5357153 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | cyclohexyl (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OC1CCCCC1 |
| InChI | InChI=1S/C15H18O2/c16-15(17-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2/b12-11+ |
| InChIKey | GCFAUZGWPDYAJN-VAWYXSNFSA-N |
| XLogP | 3.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl (E)-3-phenylprop-2-enoate?
The IUPAC name of cyclohexyl (E)-3-phenylprop-2-enoate (CID 5357153) is cyclohexyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for cyclohexyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for cyclohexyl (E)-3-phenylprop-2-enoate is O=C(/C=C/c1ccccc1)OC1CCCCC1.
What is the InChIKey of cyclohexyl (E)-3-phenylprop-2-enoate?
The InChIKey is GCFAUZGWPDYAJN-VAWYXSNFSA-N. The full InChI is InChI=1S/C15H18O2/c16-15(17-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2/b12-11+.
What are the key properties of cyclohexyl (E)-3-phenylprop-2-enoate?
cyclohexyl (E)-3-phenylprop-2-enoate has a molecular weight of 230.31 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 5357153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).