C12H26N2 — CID 5357348
(E)-N,N,N',N'-tetraethylbut-2-ene-1,4-diamine (PubChem CID 5357348) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is (E)-N,N,N',N'-tetraethylbut-2-ene-1,4-diamine.
| Compound Name | (E)-N,N,N',N'-tetraethylbut-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 5357348 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (E)-N,N,N',N'-tetraethylbut-2-ene-1,4-diamine |
| SMILES | CCN(CC)C/C=C/CN(CC)CC |
| InChI | InChI=1S/C12H26N2/c1-5-13(6-2)11-9-10-12-14(7-3)8-4/h9-10H,5-8,11-12H2,1-4H3/b10-9+ |
| InChIKey | GTSWSDCAOQCBEH-MDZDMXLPSA-N |
| XLogP | 2.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|