About Triphenylstannyl
Triphenylstannyl (PubChem CID 5357402) has the molecular formula C18H15Sn
and a molecular weight of 350.03 g/mol.
Molecular Properties
| Compound Name | Triphenylstannyl |
| PubChem CID | 5357402 |
| Molecular Formula | C18H15Sn |
| Molecular Weight | 350.03 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | — |
| SMILES | c1ccc([Sn](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/3C6H5.Sn/c3*1-2-4-6-5-3-1;/h3*1-5H; |
| InChIKey | SBXWFLISHPUINY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.03 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Triphenylstannyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triphenylstannyl?
The IUPAC name of Triphenylstannyl (CID 5357402) is not available.
What is the SMILES notation for Triphenylstannyl?
The canonical SMILES for Triphenylstannyl is c1ccc([Sn](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of Triphenylstannyl?
The InChIKey is SBXWFLISHPUINY-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H5.Sn/c3*1-2-4-6-5-3-1;/h3*1-5H;.
What are the key properties of Triphenylstannyl?
Triphenylstannyl has a molecular weight of 350.03 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Triphenylstannyl is sourced from PubChem (CID 5357402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).