About 5H-imidazo[4,5-c]pyridazin-4-amine
5H-imidazo[4,5-c]pyridazin-4-amine (PubChem CID 5357638) has the molecular formula C5H5N5
and a molecular weight of 135.13 g/mol. Its IUPAC name is 5H-imidazo[4,5-c]pyridazin-4-amine.
Molecular Properties
| Compound Name | 5H-imidazo[4,5-c]pyridazin-4-amine |
| PubChem CID | 5357638 |
| Molecular Formula | C5H5N5 |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 5H-imidazo[4,5-c]pyridazin-4-amine |
| SMILES | Nc1cnnc2nc[nH]c12 |
| InChI | InChI=1S/C5H5N5/c6-3-1-9-10-5-4(3)7-2-8-5/h1-2H,(H3,6,7,8,10) |
| InChIKey | YWFGSNCPJJPXPF-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5H-imidazo[4,5-c]pyridazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-imidazo[4,5-c]pyridazin-4-amine?
The IUPAC name of 5H-imidazo[4,5-c]pyridazin-4-amine (CID 5357638) is 5H-imidazo[4,5-c]pyridazin-4-amine.
What is the SMILES notation for 5H-imidazo[4,5-c]pyridazin-4-amine?
The canonical SMILES for 5H-imidazo[4,5-c]pyridazin-4-amine is Nc1cnnc2nc[nH]c12.
What is the InChIKey of 5H-imidazo[4,5-c]pyridazin-4-amine?
The InChIKey is YWFGSNCPJJPXPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5/c6-3-1-9-10-5-4(3)7-2-8-5/h1-2H,(H3,6,7,8,10).
What are the key properties of 5H-imidazo[4,5-c]pyridazin-4-amine?
5H-imidazo[4,5-c]pyridazin-4-amine has a molecular weight of 135.13 g/mol, XLogP of -0.06, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-imidazo[4,5-c]pyridazin-4-amine is sourced from PubChem (CID 5357638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).