About 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine
5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 5357765) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 5357765 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1c[nH]c2ncnc(N)c12 |
| InChI | InChI=1S/C7H8N4/c1-4-2-9-7-5(4)6(8)10-3-11-7/h2-3H,1H3,(H3,8,9,10,11) |
| InChIKey | ZEWNAJJTKKUMEK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CID 5357765) is 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine is Cc1c[nH]c2ncnc(N)c12.
What is the InChIKey of 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is ZEWNAJJTKKUMEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-4-2-9-7-5(4)6(8)10-3-11-7/h2-3H,1H3,(H3,8,9,10,11).
What are the key properties of 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 148.17 g/mol, XLogP of 0.85, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 5357765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).