About (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide
(E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide (PubChem CID 5358025) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide |
| PubChem CID | 5358025 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide |
| SMILES | Cn1cc(/C=C/C(N)=O)c2nccnc21 |
| InChI | InChI=1S/C10H10N4O/c1-14-6-7(2-3-8(11)15)9-10(14)13-5-4-12-9/h2-6H,1H3,(H2,11,15)/b3-2+ |
| InChIKey | BMPVDHUKDYSYAY-NSCUHMNNSA-N |
| XLogP | 0.47 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide?
The IUPAC name of (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide (CID 5358025) is (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide.
What is the SMILES notation for (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide?
The canonical SMILES for (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide is Cn1cc(/C=C/C(N)=O)c2nccnc21.
What is the InChIKey of (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide?
The InChIKey is BMPVDHUKDYSYAY-NSCUHMNNSA-N. The full InChI is InChI=1S/C10H10N4O/c1-14-6-7(2-3-8(11)15)9-10(14)13-5-4-12-9/h2-6H,1H3,(H2,11,15)/b3-2+.
What are the key properties of (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide?
(E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide has a molecular weight of 202.22 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(5-methylpyrrolo[2,3-b]pyrazin-7-yl)prop-2-enamide is sourced from PubChem (CID 5358025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).