About (E)-4-phenylbut-3-ene-1,2-diol
(E)-4-phenylbut-3-ene-1,2-diol (PubChem CID 5358441) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is (E)-4-phenylbut-3-ene-1,2-diol.
Molecular Properties
| Compound Name | (E)-4-phenylbut-3-ene-1,2-diol |
| PubChem CID | 5358441 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (E)-4-phenylbut-3-ene-1,2-diol |
| SMILES | OCC(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C10H12O2/c11-8-10(12)7-6-9-4-2-1-3-5-9/h1-7,10-12H,8H2/b7-6+ |
| InChIKey | NIKBSMYNKTUHIF-VOTSOKGWSA-N |
| XLogP | 1.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-4-phenylbut-3-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-phenylbut-3-ene-1,2-diol?
The IUPAC name of (E)-4-phenylbut-3-ene-1,2-diol (CID 5358441) is (E)-4-phenylbut-3-ene-1,2-diol.
What is the SMILES notation for (E)-4-phenylbut-3-ene-1,2-diol?
The canonical SMILES for (E)-4-phenylbut-3-ene-1,2-diol is OCC(O)/C=C/c1ccccc1.
What is the InChIKey of (E)-4-phenylbut-3-ene-1,2-diol?
The InChIKey is NIKBSMYNKTUHIF-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H12O2/c11-8-10(12)7-6-9-4-2-1-3-5-9/h1-7,10-12H,8H2/b7-6+.
What are the key properties of (E)-4-phenylbut-3-ene-1,2-diol?
(E)-4-phenylbut-3-ene-1,2-diol has a molecular weight of 164.20 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-phenylbut-3-ene-1,2-diol is sourced from PubChem (CID 5358441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).