About triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane
triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane (PubChem CID 5358442) has the molecular formula C13H28Si
and a molecular weight of 212.45 g/mol. Its IUPAC name is triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane.
Molecular Properties
| Compound Name | triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane |
| PubChem CID | 5358442 |
| Molecular Formula | C13H28Si |
| Molecular Weight | 212.45 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane |
| SMILES | CC[Si](/C=C(/C)C(C)(C)C)(CC)CC |
| InChI | InChI=1S/C13H28Si/c1-8-14(9-2,10-3)11-12(4)13(5,6)7/h11H,8-10H2,1-7H3/b12-11- |
| InChIKey | DPLDHRCPWOTBQX-QXMHVHEDSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane?
The IUPAC name of triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane (CID 5358442) is triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane.
What is the SMILES notation for triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane?
The canonical SMILES for triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane is CC[Si](/C=C(/C)C(C)(C)C)(CC)CC.
What is the InChIKey of triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane?
The InChIKey is DPLDHRCPWOTBQX-QXMHVHEDSA-N. The full InChI is InChI=1S/C13H28Si/c1-8-14(9-2,10-3)11-12(4)13(5,6)7/h11H,8-10H2,1-7H3/b12-11-.
What are the key properties of triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane?
triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane has a molecular weight of 212.45 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(Z)-2,3,3-trimethylbut-1-enyl]silane is sourced from PubChem (CID 5358442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).