C24H25NO4 — CID 5358733
dimethyl (5E,7E)-1-benzhydryl-3,4-dihydro-2H-azocine-6,7-dicarboxylate (PubChem CID 5358733) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is dimethyl (5E,7E)-1-benzhydryl-3,4-dihydro-2H-azocine-6,7-dicarboxylate.
| Compound Name | dimethyl (5E,7E)-1-benzhydryl-3,4-dihydro-2H-azocine-6,7-dicarboxylate |
|---|---|
| PubChem CID | 5358733 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | dimethyl (5E,7E)-1-benzhydryl-3,4-dihydro-2H-azocine-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C/CCCN(C(c2ccccc2)c2ccccc2)/C=C\1C(=O)OC |
| InChI | InChI=1S/C24H25NO4/c1-28-23(26)20-15-9-10-16-25(17-21(20)24(27)29-2)22(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-15,17,22H,9-10,16H2,1-2H3/b20-15+,21-17+ |
| InChIKey | IXVWXGIZKSLUDS-UKSONLHTSA-N |
| XLogP | 4.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |