C11H19N3O — CID 5358799
[(Z)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylideneamino]urea (PubChem CID 5358799) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is [(Z)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylideneamino]urea.
| Compound Name | [(Z)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylideneamino]urea |
|---|---|
| PubChem CID | 5358799 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | [(Z)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ylideneamino]urea |
| SMILES | NC(=O)N/N=C1/CCC2CCCCC2C1 |
| InChI | InChI=1S/C11H19N3O/c12-11(15)14-13-10-6-5-8-3-1-2-4-9(8)7-10/h8-9H,1-7H2,(H3,12,14,15)/b13-10- |
| InChIKey | LOMDAMPEVIEBTM-RAXLEYEMSA-N |
| XLogP | 2.00 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|