C28H38O4S — CID 5358823
[(2E,6E,8E)-5-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trienyl] acetate (PubChem CID 5358823) has the molecular formula C28H38O4S and a molecular weight of 470.68 g/mol. Its IUPAC name is [(2E,6E,8E)-5-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trienyl] acetate.
| Compound Name | [(2E,6E,8E)-5-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trienyl] acetate |
|---|---|
| PubChem CID | 5358823 |
| Molecular Formula | C28H38O4S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | [(2E,6E,8E)-5-(benzenesulfonyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6,8-trienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC(/C=C(C)/C=C/C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H38O4S/c1-21(14-15-27-23(3)11-10-17-28(27,5)6)19-26(20-22(2)16-18-32-24(4)29)33(30,31)25-12-8-7-9-13-25/h7-9,12-16,19,26H,10-11,17-18,20H2,1-6H3/b15-14+,21-19+,22-16+ |
| InChIKey | SZFVBHITSFXTKL-KNZFTCEKSA-N |
| XLogP | 6.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|