About (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole
(5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole (PubChem CID 5358824) has the molecular formula C22H17NS
and a molecular weight of 327.45 g/mol. Its IUPAC name is (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole.
Molecular Properties
| Compound Name | (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole |
| PubChem CID | 5358824 |
| Molecular Formula | C22H17NS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole |
| SMILES | C(=C1\SC(c2ccccc2)=NC1c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C22H17NS/c1-4-10-17(11-5-1)16-20-21(18-12-6-2-7-13-18)23-22(24-20)19-14-8-3-9-15-19/h1-16,21H/b20-16- |
| InChIKey | OGVIFLIVZKLLAY-SILNSSARSA-N |
| XLogP | 5.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole?
The IUPAC name of (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole (CID 5358824) is (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole.
What is the SMILES notation for (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole?
The canonical SMILES for (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole is C(=C1\SC(c2ccccc2)=NC1c1ccccc1)\c1ccccc1.
What is the InChIKey of (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole?
The InChIKey is OGVIFLIVZKLLAY-SILNSSARSA-N. The full InChI is InChI=1S/C22H17NS/c1-4-10-17(11-5-1)16-20-21(18-12-6-2-7-13-18)23-22(24-20)19-14-8-3-9-15-19/h1-16,21H/b20-16-.
What are the key properties of (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole?
(5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole has a molecular weight of 327.45 g/mol, XLogP of 5.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-benzylidene-2,4-diphenyl-4H-1,3-thiazole is sourced from PubChem (CID 5358824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).