About 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one
4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one (PubChem CID 5358944) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one |
| PubChem CID | 5358944 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one |
| SMILES | C/C=C/C1CC(OC)=CC(=O)O1 |
| InChI | InChI=1S/C9H12O3/c1-3-4-7-5-8(11-2)6-9(10)12-7/h3-4,6-7H,5H2,1-2H3/b4-3+ |
| InChIKey | HHJXJJVPAMSBSH-ONEGZZNKSA-N |
| XLogP | 1.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one?
The IUPAC name of 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one (CID 5358944) is 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one.
What is the SMILES notation for 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one?
The canonical SMILES for 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one is C/C=C/C1CC(OC)=CC(=O)O1.
What is the InChIKey of 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one?
The InChIKey is HHJXJJVPAMSBSH-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H12O3/c1-3-4-7-5-8(11-2)6-9(10)12-7/h3-4,6-7H,5H2,1-2H3/b4-3+.
What are the key properties of 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one?
4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one has a molecular weight of 168.19 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-[(E)-prop-1-enyl]-2,3-dihydropyran-6-one is sourced from PubChem (CID 5358944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).