About 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide
1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide (PubChem CID 5359148) has the molecular formula C14H17Cl2NO2
and a molecular weight of 302.20 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide.
Molecular Properties
| Compound Name | 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide |
| PubChem CID | 5359148 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide |
| SMILES | [O-]/[N+](=C\c1c(Cl)cccc1Cl)CC1(O)CCCCC1 |
| InChI | InChI=1S/C14H17Cl2NO2/c15-12-5-4-6-13(16)11(12)9-17(19)10-14(18)7-2-1-3-8-14/h4-6,9,18H,1-3,7-8,10H2/b17-9- |
| InChIKey | PSLLPYSMNCHSMW-MFOYZWKCSA-N |
| XLogP | 3.62 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide?
The IUPAC name of 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide (CID 5359148) is 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide.
What is the SMILES notation for 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide?
The canonical SMILES for 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide is [O-]/[N+](=C\c1c(Cl)cccc1Cl)CC1(O)CCCCC1.
What is the InChIKey of 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide?
The InChIKey is PSLLPYSMNCHSMW-MFOYZWKCSA-N. The full InChI is InChI=1S/C14H17Cl2NO2/c15-12-5-4-6-13(16)11(12)9-17(19)10-14(18)7-2-1-3-8-14/h4-6,9,18H,1-3,7-8,10H2/b17-9-.
What are the key properties of 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide?
1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide has a molecular weight of 302.20 g/mol, XLogP of 3.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dichlorophenyl)-N-[(1-hydroxycyclohexyl)methyl]methanimine oxide is sourced from PubChem (CID 5359148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).