C16H14N2O6 — CID 5359161
(3Z)-3,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]piperazine-2,5-dione (PubChem CID 5359161) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is (3Z)-3,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]piperazine-2,5-dione.
| Compound Name | (3Z)-3,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 5359161 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (3Z)-3,6-bis[[5-(hydroxymethyl)furan-2-yl]methylidene]piperazine-2,5-dione |
| SMILES | O=c1[nH]/c(=C\c2ccc(CO)o2)c(=O)[nH]c1=Cc1ccc(CO)o1 |
| InChI | InChI=1S/C16H14N2O6/c19-7-11-3-1-9(23-11)5-13-15(21)18-14(16(22)17-13)6-10-2-4-12(8-20)24-10/h1-6,19-20H,7-8H2,(H,17,22)(H,18,21)/b13-5-,14-6? |
| InChIKey | PSPGKXHLAKLQHC-TUGQHZFXSA-N |
| XLogP | -1.11 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |