C9H18N4O2 — CID 535921
3-(3,6-dimethyl-2-oxo-1,3-diazinan-4-yl)-1,1-dimethylurea (PubChem CID 535921) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-(3,6-dimethyl-2-oxo-1,3-diazinan-4-yl)-1,1-dimethylurea.
| Compound Name | 3-(3,6-dimethyl-2-oxo-1,3-diazinan-4-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 535921 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 3-(3,6-dimethyl-2-oxo-1,3-diazinan-4-yl)-1,1-dimethylurea |
| SMILES | CC1CC(NC(=O)N(C)C)N(C)C(=O)N1 |
| InChI | InChI=1S/C9H18N4O2/c1-6-5-7(11-8(14)12(2)3)13(4)9(15)10-6/h6-7H,5H2,1-4H3,(H,10,15)(H,11,14) |
| InChIKey | SCKOURIILZUGMP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |