About bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid
bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid (PubChem CID 5359318) has the molecular formula C20H32N2O6S
and a molecular weight of 428.55 g/mol. Its IUPAC name is bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid.
Molecular Properties
| Compound Name | bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid |
| PubChem CID | 5359318 |
| Molecular Formula | C20H32N2O6S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid |
| SMILES | CN[C@@H](C)[C@H](O)c1ccccc1.CN[C@@H](C)[C@H](O)c1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/2C10H15NO.H2O4S/c2*1-8(11-2)10(12)9-6-4-3-5-7-9;1-5(2,3)4/h2*3-8,10-12H,1-2H3;(H2,1,2,3,4)/t2*8-,10-;/m00./s1 |
| InChIKey | CAVQBDOACNULDN-KHFUBBAMSA-N |
| XLogP | 2.00 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid?
The IUPAC name of bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid (CID 5359318) is bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid.
What is the SMILES notation for bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid?
The canonical SMILES for bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid is CN[C@@H](C)[C@H](O)c1ccccc1.CN[C@@H](C)[C@H](O)c1ccccc1.O=S(=O)(O)O.
What is the InChIKey of bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid?
The InChIKey is CAVQBDOACNULDN-KHFUBBAMSA-N. The full InChI is InChI=1S/2C10H15NO.H2O4S/c2*1-8(11-2)10(12)9-6-4-3-5-7-9;1-5(2,3)4/h2*3-8,10-12H,1-2H3;(H2,1,2,3,4)/t2*8-,10-;/m00./s1.
What are the key properties of bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid?
bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid has a molecular weight of 428.55 g/mol, XLogP of 2.00, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis((1R,2S)-2-(methylamino)-1-phenylpropan-1-ol);sulfuric acid is sourced from PubChem (CID 5359318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).