C12H21NO — CID 535984
1,2,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one (PubChem CID 535984) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 1,2,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one.
| Compound Name | 1,2,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one |
|---|---|
| PubChem CID | 535984 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1,2,7-trimethyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-one |
| SMILES | CC1CCC2C(=O)CC(C)N(C)C2C1 |
| InChI | InChI=1S/C12H21NO/c1-8-4-5-10-11(6-8)13(3)9(2)7-12(10)14/h8-11H,4-7H2,1-3H3 |
| InChIKey | RDLHEHNGRCGYIR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |